For research use only. Not for therapeutic Use.
Glycol dimercaptoacetate (Cat.No:(Cat.No:I014009)) is a chemical compound used as a chelating agent in various industrial and medical applications. It has the ability to bind with heavy metals, making it useful in treating metal poisoning and as a stabilizer in metal-based formulations. Glycol dimercaptoacetate plays a vital role in environmental remediation and healthcare.
Catalog Number | M067570 |
CAS Number | 123-81-9 |
Molecular Formula | C6H10O4S2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(2-sulfanylacetyl)oxyethyl 2-sulfanylacetate |
InChI | InChI=1S/C6H10O4S2/c7-5(3-11)9-1-2-10-6(8)4-12/h11-12H,1-4H2 |
InChIKey | PSYGHMBJXWRQFD-UHFFFAOYSA-N |
SMILES | C(COC(=O)CS)OC(=O)CS |