For research use only. Not for therapeutic Use.
Glycol salicylate is a derivative of salicylic acid and can be used to improve the aesthetic appearance of the skin, extracted from patent US 20150148320 A1.
| Catalog Number | I012929 |
| CAS Number | 87-28-5 |
| Synonyms | 2-hydroxyethyl 2-hydroxybenzoate |
| Molecular Formula | C9H10O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C9H10O4/c10-5-6-13-9(12)7-3-1-2-4-8(7)11/h1-4,10-11H,5-6H2 |
| InChIKey | LVYLCBNXHHHPSB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)OCCO)O |
| Reference | [1]. Kai Xi, et al. Cosmetic use of salicylic acid derivatives. US 20150148320 A1. |
