For research use only. Not for therapeutic Use.
Glyconiazide is a biochemical with potential therapeutic activity.
| Catalog Number | I028141 |
| CAS Number | 3691-74-5 |
| Synonyms | D(+)-Glucose isonicotinoyl hydrazone; Galatone; Glucazide; Glyconiazide; INH-G |
| Molecular Formula | C12H13N3O6 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N'-((S,E)-2-((2R,3R,4S)-3,4-dihydroxy-5-oxotetrahydrofuran-2-yl)-2-hydroxyethylidene)isonicotinohydrazide |
| InChI | InChI=1S/C12H13N3O6/c16-7(10-8(17)9(18)12(20)21-10)5-14-15-11(19)6-1-3-13-4-2-6/h1-5,7-10,16-18H,(H,15,19)/b14-5+/t7-,8+,9-,10+/m0/s1 |
| InChIKey | ZBRCAASZBMWIDA-QFPUCQTMSA-N |
| SMILES | O[C@@H](C=NNC(=O)c1ccncc1)[C@H]2OC(=O)[C@@H](O)[C@H]2O |
