For research use only. Not for therapeutic Use.
Glycosmicine（Cat No.:M126261）is a synthetic derivative of the amino acid glycine, uniquely modified to include a carbamate group. This compound is significant in biochemistry and pharmaceutical research due to its role as a building block for the synthesis of various peptides and glycopeptides. Its unique structure enhances solubility and stability, making it suitable for drug development, particularly in designing compounds with improved pharmacokinetic properties. Glycosmicine’s utility extends to the study of protein interactions and enzyme regulation, providing valuable insights into cellular processes and potential therapeutic applications in metabolic and degenerative diseases.
| Catalog Number | M126261 |
| CAS Number | 604-50-2 |
| Molecular Formula | C9H8N2O2 |
| Purity | ≥95% |
| IUPAC Name | 1-methylquinazoline-2,4-dione |
| InChI | InChI=1S/C9H8N2O2/c1-11-7-5-3-2-4-6(7)8(12)10-9(11)13/h2-5H,1H3,(H,10,12,13) |
| InChIKey | RWFOOMQYIRITHL-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=O)NC1=O |
