Glycodeoxycholic acid-d6(Cat No.:S000794) is a specialized form of glycodeoxycholic acid, a bile acid crucial for lipid digestion and absorption. The “d6” designation indicates that six hydrogen atoms in the glycodeoxycholic acid molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of glycodeoxycholic acid metabolism and its incorporation into bile acid pathways using advanced analytical techniques like mass spectrometry. Glycodeoxycholic acid-d6 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating disorders related to bile acid metabolism, such as cholestatic liver diseases.
Catalog Number | S000794 |
CAS Number | 2044276-17-5 |
Molecular Formula | C26H39D4NO5 |
Purity | ≥95% |
IUPAC Name | 2-[[(4R)-4-[(3R,5S,7S,8R,9S,10S,13R,14S,17R)-2,2,4,4-tetradeuterio-3,7-dihydroxy-10,13-dimethyl-3,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetic acid |
InChI | InChI=1S/C26H43NO5/c1-15(4-7-22(30)27-14-23(31)32)18-5-6-19-24-20(9-11-26(18,19)3)25(2)10-8-17(28)12-16(25)13-21(24)29/h15-21,24,28-29H,4-14H2,1-3H3,(H,27,30)(H,31,32)/t15-,16+,17-,18-,19+,20+,21+,24+,25+,26-/m1/s1/i8D2,12D2 |
InChIKey | GHCZAUBVMUEKKP-ODDJOPSVSA-N |
SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C |