Glyoxylic Acid Hydrate-13C2(Cat No.:R032730) is an isotopically labeled form of glyoxylic acid, with both carbon atoms enriched with carbon-13 (13C). This modification enhances its utility in chemical synthesis and metabolic studies, particularly for tracking and understanding its role as a key intermediate in various biochemical pathways, including the synthesis of amino acids and the metabolism of fatty acids. Used extensively in research settings, Glyoxylic Acid Hydrate-13C2 allows for precise measurement of reaction mechanisms and dynamics, aiding in the development of new chemical processes and pharmaceutical compounds.
Catalog Number | R032730 |
CAS Number | NA |
Molecular Formula | ³C₂H₄O₄ |
Purity | 95% |
Storage | Store at RT |
IUPAC Name | 2,2-dihydroxyacetic acid |
InChI | InChI=1S/C2H4O4/c3-1(4)2(5)6/h1,3-4H,(H,5,6)/i1+1,2+1 |
InChIKey | GOCCREQJUBABAL-ZDOIIHCHSA-N |
SMILES | C(C(=O)O)(O)O |