For research use only. Not for therapeutic Use.
GNE-064(Cat No.:I042876)is a selective small molecule inhibitor designed to target and modulate key pathways involved in neurological diseases, particularly in neurodegenerative conditions. By inhibiting specific enzymes and signaling pathways, GNE-064 has shown promise in reducing neuroinflammation and promoting neuroprotection. Its potential applications include treatment for disorders like Alzheimer’s disease, Parkinson’s disease, and amyotrophic lateral sclerosis (ALS). Early studies suggest that GNE-064 could improve cognitive function and motor performance by addressing underlying pathophysiological mechanisms.
CAS Number | 1997321-20-6 |
Synonyms | 1-[(2R)-4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]-2-methylpiperazin-1-yl]ethanone |
Molecular Formula | C17H21N5O2 |
Purity | ≥95% |
IUPAC Name | 1-[(2R)-4-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]-2-methylpiperazin-1-yl]ethanone |
InChI | InChI=1S/C17H21N5O2/c1-11-10-21(7-8-22(11)12(2)23)15-9-14(19-20-17(15)18)13-5-3-4-6-16(13)24/h3-6,9,11,24H,7-8,10H2,1-2H3,(H2,18,20)/t11-/m1/s1 |
InChIKey | FHRKRGDHMCCDEO-LLVKDONJSA-N |
SMILES | C[C@@H]1CN(CCN1C(=O)C)C2=CC(=NN=C2N)C3=CC=CC=C3O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |