For research use only. Not for therapeutic Use.
GNE-490（Cat No.:I028182）is a small molecule inhibitor that targets the enzyme aldehyde dehydrogenase 2 (ALDH2), which plays a key role in metabolizing aldehydes in the body. By inhibiting ALDH2, GNE-490 has the potential to modulate oxidative stress and improve outcomes in conditions where aldehyde accumulation contributes to disease progression, such as cardiovascular disease, neurodegenerative disorders, and certain forms of cancer. Ongoing research aims to evaluate its effectiveness in improving cellular function and its therapeutic potential in treating diseases associated with oxidative damage, inflammation, and metabolic dysfunction.
| CAS Number | 1033739-92-2 |
| Synonyms | 2-[2-(2-amino-4-methylpyrimidin-5-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]propan-2-ol |
| Molecular Formula | C18H22N6O2S |
| Purity | ≥95% |
| IUPAC Name | 2-[2-(2-amino-4-methylpyrimidin-5-yl)-4-morpholin-4-ylthieno[3,2-d]pyrimidin-6-yl]propan-2-ol |
| InChI | InChI=1S/C18H22N6O2S/c1-10-11(9-20-17(19)21-10)15-22-12-8-13(18(2,3)25)27-14(12)16(23-15)24-4-6-26-7-5-24/h8-9,25H,4-7H2,1-3H3,(H2,19,20,21) |
| InChIKey | SFWTVVNNVHWDEE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC=C1C2=NC3=C(C(=N2)N4CCOCC4)SC(=C3)C(C)(C)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
