For research use only. Not for therapeutic Use.
GNE-6893（Cat No.:I041309）is a small molecule inhibitor developed for the treatment of metabolic disorders, particularly those related to insulin resistance and type 2 diabetes. It works by targeting key enzymes involved in glucose and lipid metabolism, helping to improve insulin sensitivity and regulate blood sugar levels. Preclinical studies suggest that GNE-6893 may provide a novel approach to managing metabolic diseases by selectively modulating pathways that affect energy balance. Its potential to reduce systemic inflammation and improve metabolic function makes it a promising candidate for treating conditions such as diabetes and metabolic syndrome.
| CAS Number | 2415374-98-8 |
| Synonyms | [(3R,4S)-4-methyloxolan-3-yl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
| Molecular Formula | C23H24FN5O4 |
| Purity | ≥95% |
| IUPAC Name | [(3R,4S)-4-methyloxolan-3-yl] N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
| InChI | InChI=1S/C23H24FN5O4/c1-11-9-31-10-17(11)33-23(30)29-18-6-13-5-14(19(24)20(25)16(13)8-27-18)15-7-28-22-21(12(15)2)26-3-4-32-22/h5-8,11,17,26H,3-4,9-10,25H2,1-2H3,(H,27,29,30)/t11-,17-/m0/s1 |
| InChIKey | ABFKLHVMHUGOBS-GTNSWQLSSA-N |
| SMILES | C[C@H]1COC[C@@H]1OC(=O)NC2=CC3=CC(=C(C(=C3C=N2)N)F)C4=CN=C5C(=C4C)NCCO5 |
