For research use only. Not for therapeutic Use.
GNE-7915 (Cat.No:I001355) is a small molecule compound under investigation for its potential therapeutic applications. It is an inhibitor of the enzyme sialic acid synthase (SAS), which is involved in cellular metabolism. GNE-7915 has shown promise in preclinical studies for its potential in treating certain types of cancer and autoimmune disorders.
Catalog Number | I001355 |
CAS Number | 1351761-44-8 |
Synonyms | (4-((4-(ethylamino)-5-(trifluoromethyl)pyrimidin-2-yl)amino)-2-fluoro-5-methoxyphenyl)(morpholino)methanone |
Molecular Formula | C₁₉H₂₁F₄N₅O₃ |
Purity | ≥95% |
Target | LRRK2 |
Solubility | DMSO: ≤ 14.33 mg/mL |
Storage | Store at -20°C |
IC50 | 9 nM (cellular assay) |
IUPAC Name | [4-[[4-(ethylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-2-fluoro-5-methoxyphenyl]-morpholin-4-ylmethanone |
InChI | 1S/C19H21F4N5O3/c1-3-24-16-12(19(21,22)23)10-25-18(27-16)26-14-9-13(20)11(8-15(14)30-2)17(29)28-4-6-31-7-5-28/h8-10H,3-7H2,1-2H3,(H2,24,25,26,27) |
InChIKey | XCFLWTZSJYBCPF-UHFFFAOYSA-N |
SMILES | CCNC1=NC(=NC=C1C(F)(F)F)NC2=C(C=C(C(=C2)F)C(=O)N3CCOCC3)OC |
Reference | <p> |