For research use only. Not for therapeutic Use.
GNF-8625 monopyridin-N-piperazine hydrochloride (TRKi-2), a TRK inhibitor, which is from the patent WO 2020038415 A1[1].
| Catalog Number | I045447 |
| CAS Number | 2412055-62-8 |
| Synonyms | 6-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]-3-(6-piperazin-1-ylpyridin-2-yl)imidazo[1,2-b]pyridazine;hydrochloride |
| Molecular Formula | C25H27ClFN7 |
| Purity | ≥95% |
| InChI | InChI=1S/C25H26FN7.ClH/c26-19-5-1-4-18(16-19)21-7-3-13-32(21)25-10-9-23-28-17-22(33(23)30-25)20-6-2-8-24(29-20)31-14-11-27-12-15-31;/h1-2,4-6,8-10,16-17,21,27H,3,7,11-15H2;1H/t21-;/m1./s1 |
| InChIKey | XQABKTNVPTUVLG-ZMBIFBSDSA-N |
| SMILES | C1CC(N(C1)C2=NN3C(=NC=C3C4=NC(=CC=C4)N5CCNCC5)C=C2)C6=CC(=CC=C6)F.Cl |
| Reference | [1]. By Liu, Jing, et al. Preparation of tropomyosin receptor kinase degradation compounds and methods of use. WO 2020038415 A1. |
