For research use only. Not for therapeutic Use.
GNF6702（Cat No.:I028194）is a selective small molecule inhibitor targeting the B-cell lymphoma 2 (BCL-2) family of proteins, which play a critical role in regulating apoptosis (programmed cell death). By inhibiting specific anti-apoptotic proteins within this family, GNF6702 can promote cell death in cancer cells, making it a potential therapeutic candidate for treating various types of cancer, particularly those resistant to conventional therapies. Ongoing research is focused on evaluating its efficacy, safety, and potential use in combination with other cancer treatments to improve clinical outcomes in oncology.
| CAS Number | 1799329-72-8 |
| Synonyms | N-[4-fluoro-3-(6-pyridin-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| Molecular Formula | C22H16FN7O2 |
| Purity | ≥95% |
| IUPAC Name | N-[4-fluoro-3-(6-pyridin-2-yl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)phenyl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| InChI | InChI=1S/C22H16FN7O2/c1-12-19(32-13(2)26-12)21(31)27-15-6-7-17(23)16(9-15)20-28-22-25-10-14(11-30(22)29-20)18-5-3-4-8-24-18/h3-11H,1-2H3,(H,27,31) |
| InChIKey | WXZFCGRYVWYYTG-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=N1)C)C(=O)NC2=CC(=C(C=C2)F)C3=NN4C=C(C=NC4=N3)C5=CC=CC=N5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
