For research use only. Not for therapeutic Use.
Goitrine（Cat No.:R014221）is a potent naturally occurring alkaloid known for its effects on the thyroid gland. It acts as a goitrogen by inhibiting the synthesis of thyroid hormones, primarily by interfering with iodine uptake into the thyroid, which can result in the enlargement of the thyroid (goiter). It has been studied for its potential therapeutic applications, particularly in metabolic and endocrine disorders. Goitrine is also used in scientific research to investigate thyroid hormone regulation and its effects on thyroid function. Its precise mechanism of action continues to be an area of active research.
| Catalog Number | R014221 |
| CAS Number | 1072-93-1 |
| Synonyms | (R)-5-Ethenyl-2-oxazolidinethione; (R)-5-Vinyl-2-oxazolidinethione;?(+)-5-Vinyl-2-oxazolidinethione; (R)-5-Vinyloxazolidine-2-thione; (R)-Goitrin?Ba 51-090278; Epigoitrin; epi-Goitrin |
| Molecular Formula | C5H7NOS |
| Purity | ≥95% |
| Target | Influenza Virus |
| Storage | Store at -20°C |
| IUPAC Name | (5R)-5-ethenyl-1,3-oxazolidine-2-thione |
| InChI | InChI=1S/C5H7NOS/c1-2-4-3-6-5(8)7-4/h2,4H,1,3H2,(H,6,8)/t4-/m1/s1 |
| InChIKey | UZQVYLOFLQICCT-SCSAIBSYSA-N |
| SMILES | C=C[C@@H]1CNC(=S)O1 |
