For research use only. Not for therapeutic Use.
Gonyautoxin 3 (GTX3) is a potent neurotoxin belonging to the family of paralytic shellfish toxins (PSTs). It is produced by certain species of marine dinoflagellates, such as Alexandrium, and can accumulate in shellfish, leading to paralytic shellfish poisoning (PSP) in humans when consumed. GTX3 works by blocking voltage-gated sodium channels in nerve cells, preventing the conduction of nerve impulses and leading to symptoms such as numbness, paralysis, and in severe cases, respiratory failure. Due to its high toxicity, Gonyautoxin 3 is of significant concern in food safety and environmental monitoring, especially in coastal regions.
CAS Number | 60537-65-7 |
Synonyms | (3aS,4R,9R,10aS)-2,6-Diamino-4-[[(aminocarbonyl)oxy]methyl]-3a,4,8,9-tetrahydro-1H,10H-pyrrolo[1,2-c]purine-9,10,10-triol 9-(Hydrogen Sulfate); (+)-Gonyautoxin 3; 11β-Hydroxysaxitoxin 11-sulfate; GTX III; GTX3; Gonyautoxin III; Toxin GTX3; |
Molecular Formula | C10H17N7O8S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-9-sulfooxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
InChI | InChI=1S/C10H17N7O8S/c11-6-15-5-3(2-24-8(13)18)14-7(12)17-1-4(25-26(21,22)23)10(19,20)9(5,17)16-6/h3-5,19-20H,1-2H2,(H2,12,14)(H2,13,18)(H3,11,15,16)(H,21,22,23)/t3-,4-,5-,9-/m0/s1 |
InChIKey | ARSXTTJGWGCRRR-LJRZAWCWSA-N |
SMILES | C1C(C(C23N1C(=NC(C2N=C(N3)N)COC(=O)N)N)(O)O)OS(=O)(=O)O |