For research use only. Not for therapeutic Use.
GPR132 antagonist 1 (Cat No.: I040166) is a small-molecule compound that selectively inhibits GPR132, a G-protein coupled receptor (GPCR) implicated in various biological processes, including inflammation, immune response, and cancer progression. By blocking GPR132 activation, this antagonist can modulate immune cell signaling and reduce inflammation, making it a promising candidate for treating autoimmune disorders, chronic inflammation, and certain cancers. Ongoing research into GPR132 antagonist 1 explores its potential to improve therapeutic outcomes by targeting immune regulation and tumor microenvironments in disease management.
| CAS Number | 898211-21-7 |
| Synonyms | 3-methyl-5-(2-phenylethylsulfamoyl)-1-benzofuran-2-carboxylic acid |
| Molecular Formula | C18H17NO5S |
| Purity | ≥95% |
| InChI | InChI=1S/C18H17NO5S/c1-12-15-11-14(7-8-16(15)24-17(12)18(20)21)25(22,23)19-10-9-13-5-3-2-4-6-13/h2-8,11,19H,9-10H2,1H3,(H,20,21) |
| InChIKey | XFMCZHXUAWBOAL-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=C(C=C2)S(=O)(=O)NCCC3=CC=CC=C3)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
