For research use only. Not for therapeutic Use.
GPR35 Agonist 4（Cat No.:I010924）is a small molecule designed to selectively activate GPR35, a G-protein-coupled receptor (GPCR) that plays a role in regulating various physiological processes, including immune responses, inflammation, and gastrointestinal function. GPR35 is associated with diseases like inflammatory bowel disease and cardiovascular conditions. By activating this receptor, GPR35 Agonist 4 could potentially modulate immune cell activity, reduce inflammation, and protect against tissue damage. Research is ongoing to evaluate its therapeutic potential in managing inflammatory disorders, gastrointestinal diseases, and possibly other conditions involving GPCR signaling.
| CAS Number | 871085-49-3 |
| Molecular Formula | C12H9NO5S |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetic acid |
| InChI | InChI=1S/C12H9NO5S/c14-10(15)6-18-8-3-1-7(2-4-8)5-9-11(16)13-12(17)19-9/h1-5H,6H2,(H,14,15)(H,13,16,17)/b9-5- |
| InChIKey | WXMCOLGPDOYHNK-UITAMQMPSA-N |
| SMILES | C1=CC(=CC=C1/C=C\2/C(=O)NC(=O)S2)OCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
