For research use only. Not for therapeutic Use.
GPR52 Antagonist-1（Cat No.:I025081）is a small molecule designed to block the activity of GPR52, a G-protein-coupled receptor that is involved in regulating various neurophysiological processes, including neurotransmitter release and signal transduction in the brain. GPR52 has been linked to neurological disorders, such as schizophrenia and Parkinson’s disease, making it a potential therapeutic target. By inhibiting GPR52, Antagonist-1 may help modulate brain activity and reduce symptoms associated with these conditions. Ongoing research is focused on evaluating its efficacy, safety, and potential as a treatment for neurological and psychiatric disorders.
| CAS Number | 1239987-91-7 |
| Synonyms | (E)-5-phenyl-1-thiophen-2-ylpent-2-en-1-one |
| Molecular Formula | C15H14OS |
| Purity | ≥95% |
| IUPAC Name | (E)-5-phenyl-1-thiophen-2-ylpent-2-en-1-one |
| InChI | InChI=1S/C15H14OS/c16-14(15-11-6-12-17-15)10-5-4-9-13-7-2-1-3-8-13/h1-3,5-8,10-12H,4,9H2/b10-5+ |
| InChIKey | XUIAIACHIPOOHR-BJMVGYQFSA-N |
| SMILES | C1=CC=C(C=C1)CC/C=C/C(=O)C2=CC=CS2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
