For research use only. Not for therapeutic Use.
GPX100（Cat No.:I007020）is a small-molecule, investigational drug being explored primarily for its potential as an anti-cancer agent. It functions as a selective inhibitor of a specific protein, which is involved in critical cellular processes such as survival, growth, and metastasis of cancer cells. GPX100 has demonstrated preclinical efficacy in inhibiting tumor growth and sensitizing cancer cells to chemotherapy and radiation. Research is ongoing to evaluate its pharmacokinetics, safety, and efficacy in various cancer types. GPX100 holds promise as part of targeted therapy regimens for oncology treatment.
| Catalog Number | I007020 |
| CAS Number | 952648-77-0 |
| Synonyms | GPX100; GPX 100; GPX-100; 13deoxydoxorubicin.;(8R,10S)-10-(((2S,4S,5R,6S)-4-amino-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-6,8,11-trihydroxy-8-(2-hydroxyethyl)-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
| Molecular Formula | C27H31NO10 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term or -20 °C for long term |
| IUPAC Name | 7-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-6,9,11-trihydroxy-9-(2-hydroxyethyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| InChI | InChI=1S/C27H31NO10/c1-11-22(30)14(28)8-17(37-11)38-16-10-27(35,6-7-29)9-13-19(16)26(34)21-20(24(13)32)23(31)12-4-3-5-15(36-2)18(12)25(21)33/h3-5,11,14,16-17,22,29-30,32,34-35H,6-10,28H2,1-2H3 |
| InChIKey | RGVRUQHYQSORBY-UHFFFAOYSA-N |
| SMILES | CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(CCO)O)N)O |
| Reference | </br>1: Slupe A, Williams B, Larson C, Lee LM, Primbs T, Bruesch AJ, Bjorklund C, Warner DL, Peloquin J, Shadle SE, Gambliel HA, Cusack BJ, Olson RD, Charlier HA Jr. Reduction of 13-deoxydoxorubicin and daunorubicinol anthraquinones by human carbonyl |
