For research use only. Not for therapeutic Use.
GR 218,231 is a selective D3 dopamine receptor antagonist.
| Catalog Number | I007030 |
| CAS Number | 175442-95-2 |
| Synonyms | GR 218,231; GR218,231; GR-218,231.;(2R)-6-[(4-methoxyphenyl)sulfonylmethyl]-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| Molecular Formula | C24H33NO3S |
| Purity | ≥95% |
| Target | D3 Receptor antagonist |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| IUPAC Name | (2R)-6-[(4-methoxyphenyl)sulfonylmethyl]-N,N-dipropyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| InChI | InChI=1S/C24H33NO3S/c1-4-14-25(15-5-2)22-9-8-20-16-19(6-7-21(20)17-22)18-29(26,27)24-12-10-23(28-3)11-13-24/h6-7,10-13,16,22H,4-5,8-9,14-15,17-18H2,1-3H3/t22-/m1/s1 |
| InChIKey | HUXFXXWYIRBVJR-JOCHJYFZSA-N |
| SMILES | CCCN(CCC)C1CCC2=C(C1)C=CC(=C2)CS(=O)(=O)C3=CC=C(C=C3)OC |
| Reference | </br>1:de Vries EF, Kortekaas R, van Waarde A, Dijkstra D, Elsinga PH, Vaalburg W. Synthesis and evaluation of dopamine D3 receptor antagonist 11C-GR218231 as PET tracer for P-glycoprotein. J Nucl Med. 2005 Aug;46(8):1384-92. PubMed PMID: 16085598. |
