For research use only. Not for therapeutic Use.
GR79236（Cat No.:I000974）is a synthetic compound that belongs to a class of selective modulators, potentially used for treating central nervous system disorders. It functions as a partial agonist of certain serotonin receptors, notably the 5-HT2C receptor, which may influence mood and behavior. GR79236 has been explored for its potential therapeutic effects in conditions like depression, anxiety, and schizophrenia, though its clinical application is still under investigation. The compound is also studied for its neuropsychiatric properties, particularly its ability to balance serotonin signaling in the brain. Further research is needed to fully evaluate its efficacy and safety.
| Catalog Number | I000974 |
| CAS Number | 124555-18-6 |
| Synonyms | (2S,3R,4S,5R)-2-(6-(((1S,2S)-2-hydroxycyclopentyl)amino)-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol |
| Molecular Formula | C15H21N5O5 |
| Purity | ≥95% |
| Target | Adenosine Receptor |
| Solubility | 100 mM in H2O |
| Storage | Desiccate at +4C |
| IC50 | 3.1 nM(Ki) |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[[(1S,2S)-2-hydroxycyclopentyl]amino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChI | InChI=1S/C15H21N5O5/c21-4-9-11(23)12(24)15(25-9)20-6-18-10-13(16-5-17-14(10)20)19-7-2-1-3-8(7)22/h5-9,11-12,15,21-24H,1-4H2,(H,16,17,19)/t7-,8-,9+,11+,12+,15+/m0/s1 |
| InChIKey | GYWXTRVEUURNEW-TVDBPQCTSA-N |
| SMILES | C1C[C@@H]([C@H](C1)O)NC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O |
