For research use only. Not for therapeutic Use.
Grepafloxacin hydrochloride（Cat No.:I006973）is a broad-spectrum fluoroquinolone antibiotic used to treat a variety of bacterial infections, including respiratory tract infections, urinary tract infections, and skin infections. It works by inhibiting bacterial DNA gyrase and topoisomerase IV, enzymes crucial for DNA replication and transcription, thereby preventing bacterial cell division and growth. Grepafloxacin is effective against both gram-positive and gram-negative bacteria. However, due to safety concerns and the availability of newer antibiotics, its use has become limited. It may cause side effects such as gastrointestinal disturbances and potential cardiovascular risks in some patients.
| CAS Number | 161967-81-3 |
| Synonyms | 1-cyclopropyl-6-fluoro-5-methyl-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride |
| Molecular Formula | C19H23ClFN3O3 |
| Purity | ≥95% |
| IUPAC Name | 1-cyclopropyl-6-fluoro-5-methyl-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride |
| InChI | InChI=1S/C19H22FN3O3.ClH/c1-10-8-22(6-5-21-10)15-7-14-16(11(2)17(15)20)18(24)13(19(25)26)9-23(14)12-3-4-12;/h7,9-10,12,21H,3-6,8H2,1-2H3,(H,25,26);1H |
| InChIKey | IEPMBYOIQGCVHO-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1)C2=C(C(=C3C(=C2)N(C=C(C3=O)C(=O)O)C4CC4)C)F.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
