For research use only. Not for therapeutic Use.
GRGDNP (Cat No.: M016825) is a synthetic peptide composed of the amino acid sequence Gly-Arg-Gly-Asp-Asn-Pro. It is a variant of the well-known RGD (Arg-Gly-Asp) sequence, which is crucial for cell adhesion to extracellular matrix proteins, particularly in the context of integrin receptor binding. GRGDNP has been studied for its potential in drug delivery, tissue engineering, and wound healing, where its ability to modulate cell interactions can promote cell attachment and migration, aiding tissue regeneration and repair.
CAS Number | 114681-65-1 |
Synonyms | GRGDNP;H-Gly-Arg-Gly-Asp-Asn-Pro-OH |
Molecular Formula | C23H38N10O10 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (2S)-1-[(2S)-4-amino-2-[[(2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-3-carboxypropanoyl]amino]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C23H38N10O10/c24-9-16(35)30-11(3-1-5-28-23(26)27)19(39)29-10-17(36)31-12(8-18(37)38)20(40)32-13(7-15(25)34)21(41)33-6-2-4-14(33)22(42)43/h11-14H,1-10,24H2,(H2,25,34)(H,29,39)(H,30,35)(H,31,36)(H,32,40)(H,37,38)(H,42,43)(H4,26,27,28)/t11-,12-,13-,14-/m0/s1 |
InChIKey | CWAHAVYVGPRZJU-XUXIUFHCSA-N |
SMILES | C1CC(N(C1)C(=O)C(CC(=O)N)NC(=O)C(CC(=O)O)NC(=O)CNC(=O)C(CCCN=C(N)N)NC(=O)CN)C(=O)O |