For research use only. Not for therapeutic Use.
Grifolin is a natural compound isolated from the mushroom Albatrellus confluens. It possesses diverse biological activities, including antitumor, antiviral, and immunomodulatory effects. Grifolin’s mechanism of action involves inhibition of certain enzymes and pathways involved in tumor growth and viral replication. Ongoing research investigates its potential in cancer therapy and antiviral drug development, highlighting its significance in medicinal chemistry and pharmacology.
Catalog Number | R032871 |
CAS Number | 6903-07-7 |
Synonyms | (E,E)- 5-methyl-2-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-resorcinol; 5-Methyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienyl]-1,3-benzenediol; (E,E)-5-Methyl-2-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-1,3-benzenediol, |
Molecular Formula | C22H32O2 |
Purity | 98% |
Target | Apoptosis |
Appearance | powder |
Storage | -20°C |
IUPAC Name | 5-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene-1,3-diol |
InChI | InChI=1S/C22H32O2/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-20-21(23)14-19(5)15-22(20)24/h8,10,12,14-15,23-24H,6-7,9,11,13H2,1-5H3/b17-10+,18-12+ |
InChIKey | PZHNKNRPGLTZPO-VZRGJMDUSA-N |
SMILES | CC1=CC(=C(C(=C1)O)CC=C(C)CCC=C(C)CCC=C(C)C)O |