For research use only. Not for therapeutic Use.
GRK2 Inhibitor 1（Cat No.:R040855）is a small molecule that selectively targets and inhibits G protein-coupled receptor kinase 2 (GRK2), an enzyme involved in the regulation of G protein-coupled receptor (GPCR) signaling. GRK2 plays a role in controlling cellular responses to various external signals and is implicated in heart failure, hypertension, and other cardiovascular diseases. By inhibiting GRK2, this compound may help modulate GPCR signaling and improve cellular function in diseased tissues. Research is ongoing to explore its therapeutic potential in treating cardiovascular conditions, inflammation, and other diseases linked to GRK2 dysregulation.
| CAS Number | 24269-96-3 |
| Synonyms | methyl 5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]furan-2-carboxylate |
| Molecular Formula | C12H9NO6 |
| Purity | ≥95% |
| IUPAC Name | methyl 5-[(E)-2-(5-nitrofuran-2-yl)ethenyl]furan-2-carboxylate |
| InChI | InChI=1S/C12H9NO6/c1-17-12(14)10-6-4-8(18-10)2-3-9-5-7-11(19-9)13(15)16/h2-7H,1H3/b3-2+ |
| InChIKey | YDJPHSNZGRVPCK-NSCUHMNNSA-N |
| SMILES | COC(=O)C1=CC=C(O1)/C=C/C2=CC=C(O2)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
