For research use only. Not for therapeutic Use.
GRP78-IN-3（Cat No.:I042280）is a small molecule inhibitor designed to target GRP78 (Glucose-Regulated Protein 78), a molecular chaperone that plays a crucial role in protein folding and stress response within the endoplasmic reticulum (ER). GRP78 is often overexpressed in various cancer cells, where it helps tumor cells survive under stressful conditions like hypoxia and nutrient deprivation. By inhibiting GRP78, GRP78-IN-3 aims to disrupt cancer cell survival mechanisms, potentially sensitizing tumors to chemotherapy and reducing resistance. This makes GRP78-IN-3 a promising candidate for cancer therapy, particularly in cancers with high GRP78 expression.
| Catalog Number | I042280 |
| CAS Number | 2707510-30-1 |
| Synonyms | N-[(2S)-3-methyl-1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]-1H-indole-2-carboxamide |
| Molecular Formula | C17H18N4O2S |
| Purity | ≥95% |
| IUPAC Name | N-[(2S)-3-methyl-1-oxo-1-(1,3-thiazol-2-ylamino)butan-2-yl]-1H-indole-2-carboxamide |
| InChI | InChI=1S/C17H18N4O2S/c1-10(2)14(16(23)21-17-18-7-8-24-17)20-15(22)13-9-11-5-3-4-6-12(11)19-13/h3-10,14,19H,1-2H3,(H,20,22)(H,18,21,23)/t14-/m0/s1 |
| InChIKey | XOWYFNSUXHAORU-AWEZNQCLSA-N |
| SMILES | CC(C)[C@@H](C(=O)NC1=NC=CS1)NC(=O)C2=CC3=CC=CC=C3N2 |
