For research use only. Not for therapeutic Use.
GS-9620 (CAT: I000892) is a potent and selective Toll-like receptor 7 (TLR7) agonist. It activates the innate immune system by binding to and stimulating TLR7, which leads to the production of pro-inflammatory cytokines such as interferon-alpha (IFN-α) and tumor necrosis factor-alpha (TNF-α). GS-9620 has demonstrated antiviral activity against various viruses, including hepatitis B virus (HBV) and hepatitis C virus (HCV), by enhancing the immune response against viral infections. It is being investigated for its potential use in the treatment of chronic viral infections, particularly in the field of viral hepatitis. GS-9620 holds promise as an immunomodulatory agent with the potential to enhance antiviral responses and improve clinical outcomes in certain viral diseases.
CAS Number | 1228585-88-3 |
Synonyms | 4-amino-2-butoxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
Molecular Formula | C22H30N6O2 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 4.8 mg/mL (Need ultrasonic), DMSO < 16.4 mg/mL |
Storage | Store at -20°C |
IUPAC Name | 4-amino-2-butoxy-8-[[3-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5,7-dihydropteridin-6-one |
InChI | InChI=1S/C22H30N6O2/c1-2-3-11-30-22-25-20(23)19-21(26-22)28(15-18(29)24-19)14-17-8-6-7-16(12-17)13-27-9-4-5-10-27/h6-8,12H,2-5,9-11,13-15H2,1H3,(H,24,29)(H2,23,25,26) |
InChIKey | VFOKSTCIRGDTBR-UHFFFAOYSA-N |
SMILES | O=C(NC1=C2N=C(OCCCC)N=C1N)CN2CC3=CC(CN4CCCC4)=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |