For research use only. Not for therapeutic Use.
TWS119（Cat No.:I004259）is a selective inhibitor of glycogen synthase kinase-3β (GSK-3β), a key enzyme in multiple signaling pathways, including Wnt/β-catenin, which regulates cell proliferation and differentiation. By inhibiting GSK-3β, TWS119 promotes β-catenin stabilization, leading to enhanced transcription of Wnt target genes. It has been widely used in stem cell research to support self-renewal and differentiation, particularly for neuronal and mesenchymal stem cells. TWS119 is also studied in the context of neurodegenerative diseases, cancer, and metabolic disorders, providing insights into the therapeutic potential of GSK-3β modulation.
| Catalog Number | I004259 |
| CAS Number | 601514-19-6 |
| Synonyms | 3-[[6-(3-aminophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenol |
| Molecular Formula | C₁₈H₁₄N₄O₂ |
| Purity | ≥95% |
| Target | GSK-3 |
| Solubility | DMSO ≥61mg/mL Water <1.2mg/mL Ethanol <1.2mg/mL |
| Storage | 3 years -20℃ powder |
| IC50 | 30 nM |
| IUPAC Name | 3-[[6-(3-aminophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenol |
| InChI | InChI=1S/C18H14N4O2/c19-12-4-1-3-11(7-12)16-9-15-17(22-16)20-10-21-18(15)24-14-6-2-5-13(23)8-14/h1-10,23H,19H2,(H,20,21,22) |
| InChIKey | VPVLEBIVXZSOMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC3=C(N2)N=CN=C3OC4=CC=CC(=C4)O |
| Reference | <p style=/line-height:25px/> |
