For research use only. Not for therapeutic Use.
GSK-3 Inhibitor 3（Cat No.:I041059）is a small molecule designed to inhibit glycogen synthase kinase-3 (GSK-3), a key enzyme involved in regulating various cellular processes, including metabolism, cell cycle progression, and apoptosis. By blocking GSK-3 activity, this inhibitor may have therapeutic potential in treating conditions such as neurodegenerative diseases (like Alzheimer’s), mood disorders, and certain cancers. Inhibiting GSK-3 can promote cell survival, enhance neurogenesis, and regulate insulin signaling, offering a promising strategy to address disorders linked to GSK-3 dysregulation. Research into its efficacy and safety continues.
| CAS Number | 2227279-84-5 |
| Synonyms | 2-(4-cyanoanilino)-N-[4-(4-fluorophenyl)pyridin-3-yl]pyrimidine-4-carboxamide |
| Molecular Formula | C23H15FN6O |
| Purity | ≥95% |
| IUPAC Name | 2-(4-cyanoanilino)-N-[4-(4-fluorophenyl)pyridin-3-yl]pyrimidine-4-carboxamide |
| InChI | InChI=1S/C23H15FN6O/c24-17-5-3-16(4-6-17)19-9-11-26-14-21(19)29-22(31)20-10-12-27-23(30-20)28-18-7-1-15(13-25)2-8-18/h1-12,14H,(H,29,31)(H,27,28,30) |
| InChIKey | QLWFPXXGZGCHFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)NC2=NC=CC(=N2)C(=O)NC3=C(C=CN=C3)C4=CC=C(C=C4)F |
