For research use only. Not for therapeutic Use.
GSK-7975A (CAT: I007121) is a potent and orally active inhibitor of ORAI1, a calcium release-activated calcium modulator. ORAI1 is a key component of the calcium release-activated calcium channels, which play a crucial role in calcium signaling and cellular processes. By inhibiting ORAI1, GSK-7975A interferes with calcium entry into cells, thereby modulating calcium-dependent signaling pathways. This inhibition of ORAI1 may have potential therapeutic applications in various diseases associated with dysregulated calcium signaling, such as autoimmune disorders and certain types of cancer.
| Catalog Number | I007121 |
| CAS Number | 1253186-56-9 |
| Synonyms | GSK-7975A; GSK 7975A; GSK7975A; GSK-7975; GSK 7975; GSK7975.;2,6-difluoro-N-(1-(4-hydroxy-2-(trifluoromethyl)benzyl)-1H-pyrazol-3-yl)benzamide |
| Molecular Formula | C18H12F5N3O2 |
| Purity | ≥95% |
| Target | ORAI1 inhibitor |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term or -20 °C for long term |
| SMILES | O=C(NC1=NN(CC2=CC=C(O)C=C2C(F)(F)F)C=C1)C3=C(F)C=CC=C3F |
| Reference | </br>1: Duffy SM, Ashmole I, Smallwood DT, Leyland ML, Bradding P. Orai/CRACM1 and KCa3.1 ion channels interact in the human lung mast cell plasma membrane. Cell Commun Signal. 2015 Jul 16;13:32. doi: 10.1186/s12964-015-0112-z. PubMed PMID: 26177720; PubM |
