GSK-923295（Cat No.:I000375）is a selective inhibitor of the protein kinase Aurora A, which plays a critical role in cell division and mitotic processes. By inhibiting Aurora A, GSK-923295 disrupts the proper alignment and segregation of chromosomes during mitosis, leading to the inhibition of cancer cell proliferation. It has shown promising results in preclinical studies against various cancers, including solid tumors and hematologic malignancies. The compound is under investigation in clinical trials to evaluate its safety, efficacy, and potential as a targeted therapy, particularly in cancers with overexpressed Aurora A.
| Catalog Number | I000375 |
| CAS Number | 1088965-37-0 |
| Synonyms | 3-chloro-N-[(2S)-1-[[2-(dimethylamino)acetyl]amino]-3-[4-[8-[(1S)-1-hydroxyethyl]imidazo[1,2-a]pyridin-2-yl]phenyl]propan-2-yl]-4-propan-2-yloxybenzamide |
| Molecular Formula | C32H38ClN5O4 |
| Purity | ≥95% |
| Target | Kinesin |
| Solubility | in DMSO > 10 mM |
| Storage | Store at -20°C |
| IC50 | 3.2 nM(Ki) |
| IUPAC Name | 3-chloro-N-[(2S)-1-[[2-(dimethylamino)acetyl]amino]-3-[4-[8-[(1S)-1-hydroxyethyl]imidazo[1,2-a]pyridin-2-yl]phenyl]propan-2-yl]-4-propan-2-yloxybenzamide |
| InChI | InChI=1S/C32H38ClN5O4/c1-20(2)42-29-13-12-24(16-27(29)33)32(41)35-25(17-34-30(40)19-37(4)5)15-22-8-10-23(11-9-22)28-18-38-14-6-7-26(21(3)39)31(38)36-28/h6-14,16,18,20-21,25,39H,15,17,19H2,1-5H3,(H,34,40)(H,35,41)/t21-,25-/m0/s1 |
| InChIKey | WHMXDBPHBVLYRC-OFVILXPXSA-N |
| SMILES | C[C@@H](C1=CC=CN2C1=NC(=C2)C3=CC=C(C=C3)C[C@@H](CNC(=O)CN(C)C)NC(=O)C4=CC(=C(C=C4)OC(C)C)Cl)O |
| Reference | <p style=/line-height:25px/> |
