For research use only. Not for therapeutic Use.
GSK-F1（Cat No.:I028426）is a selective small molecule inhibitor that targets specific enzymes or proteins involved in cellular signaling, often related to cancer and metabolic diseases. By modulating critical pathways, GSK-F1 can influence cellular processes like growth, apoptosis, and metabolic regulation. It is being researched for its potential therapeutic applications in oncology, where it may help to inhibit tumor progression or sensitize cancer cells to other treatments. Ongoing studies aim to explore its efficacy in clinical settings, evaluating its safety, specificity, and potential as part of combination therapies in cancer and other diseases.
| CAS Number | 1402345-92-9 |
| Synonyms | 5-[2-amino-4-oxo-3-[2-(trifluoromethyl)phenyl]quinazolin-6-yl]-N-(2,4-difluorophenyl)-2-methoxypyridine-3-sulfonamide |
| Molecular Formula | C27H18F5N5O4S |
| Purity | ≥95% |
| IUPAC Name | 5-[2-amino-4-oxo-3-[2-(trifluoromethyl)phenyl]quinazolin-6-yl]-N-(2,4-difluorophenyl)-2-methoxypyridine-3-sulfonamide |
| InChI | InChI=1S/C27H18F5N5O4S/c1-41-24-23(42(39,40)36-21-9-7-16(28)12-19(21)29)11-15(13-34-24)14-6-8-20-17(10-14)25(38)37(26(33)35-20)22-5-3-2-4-18(22)27(30,31)32/h2-13,36H,1H3,(H2,33,35) |
| InChIKey | MSRFVAYVUUHQCN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)C2=CC3=C(C=C2)N=C(N(C3=O)C4=CC=CC=C4C(F)(F)F)N)S(=O)(=O)NC5=C(C=C(C=C5)F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
