For research use only. Not for therapeutic Use.
GSK046 (Cat.No:I014898) is a chemical compound developed for research purposes. It acts as an inhibitor of bromodomain and extra-terminal (BET) proteins, which play a role in gene regulation. GSK046 has shown promise in preclinical studies for its potential anti-inflammatory and anticancer effects, making it an area of interest for therapeutic development.
| Catalog Number | I014898 |
| CAS Number | 2474876-09-8 |
| Molecular Formula | C₂₃H₂₇FN₂O₄ |
| Purity | ≥95% |
| Target | Epigenetic Reader Domain |
| IUPAC Name | 4-acetamido-3-fluoro-N-(4-hydroxycyclohexyl)-5-[(1S)-1-phenylethoxy]benzamide |
| InChI | InChI=1S/C23H27FN2O4/c1-14(16-6-4-3-5-7-16)30-21-13-17(12-20(24)22(21)25-15(2)27)23(29)26-18-8-10-19(28)11-9-18/h3-7,12-14,18-19,28H,8-11H2,1-2H3,(H,25,27)(H,26,29)/t14-,18?,19?/m0/s1 |
| InChIKey | FRBRZGLUFOZRGD-YCMKEVRSSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)OC2=C(C(=CC(=C2)C(=O)NC3CCC(CC3)O)F)NC(=O)C |
| Reference | [1]. Omer G, et, al. Selective targeting of BD1 and BD2 of the BET proteins in cancer and immunoinflammation. Science. 2020 Apr 24; 368(6489): 387-394. |
