For research use only. Not for therapeutic Use.
GSK106（Cat No.:R065571）is a small molecule compound being investigated for its potential therapeutic applications in oncology and other disease areas. It is designed to target specific enzymes or proteins involved in critical cellular processes such as cell survival, proliferation, and apoptosis. By modulating these pathways, GSK106 may help inhibit tumor growth and overcome resistance to conventional cancer treatments. Research is ongoing to evaluate its effectiveness in treating various types of cancer, with a focus on its safety, pharmacokinetics, and potential as part of combination therapies for more efficient and targeted treatment outcomes.
| CAS Number | 1652591-82-6 |
| Synonyms | (3-aminopiperidin-1-yl)-[2-(1-ethylindol-2-yl)-3-methylbenzimidazol-5-yl]methanone;hydrochloride |
| Molecular Formula | C24H28ClN5O |
| Purity | ≥95% |
| IUPAC Name | (3-aminopiperidin-1-yl)-[2-(1-ethylindol-2-yl)-3-methylbenzimidazol-5-yl]methanone;hydrochloride |
| InChI | InChI=1S/C24H27N5O.ClH/c1-3-29-20-9-5-4-7-16(20)13-22(29)23-26-19-11-10-17(14-21(19)27(23)2)24(30)28-12-6-8-18(25)15-28;/h4-5,7,9-11,13-14,18H,3,6,8,12,15,25H2,1-2H3;1H |
| InChIKey | VRPFLFUQMWOJAT-UHFFFAOYSA-N |
| SMILES | CCN1C2=CC=CC=C2C=C1C3=NC4=C(N3C)C=C(C=C4)C(=O)N5CCCC(C5)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
