For research use only. Not for therapeutic Use.
GSK1278863 (Cat No.:I005696) is indeed a selective and potent small molecule inhibitor of hypoxia-inducible factor (HIF) prolyl hydroxylase (PHD). By inhibiting PHD enzymes, GSK1278863 stabilizes HIF proteins and promotes their transcriptional activity, leading to increased expression of HIF target genes involved in cellular adaptation to hypoxia. This compound has shown promise in preclinical studies for its potential therapeutic applications in conditions associated with inadequate oxygen supply, such as anemia and ischemic diseases. Additionally, GSK1278863 has been investigated as a potential treatment for various types of cancer, as HIF activation is often associated with tumor progression and metastasis.
| Catalog Number | I005696 |
| CAS Number | 960539-70-2 |
| Synonyms | GSK1278863; N-[(1,3-Dicyclohexylhexahydro-2,4,6-trioxo-5-pyrimidinyl)carbonyl]glycine |
| Molecular Formula | C19H27N3O6 |
| Purity | 95% |
| Target | HIF-PHI |
| Target Protein | |
| Solubility | DMSO: ＜ 6.8 mg/mL |
| Appearance | Solid |
| Storage | Dry, dark and at 2 - 8 °C for six months or -20°C for two years. |
| IUPAC Name | 2-[(1,3-dicyclohexyl-2,4,6-trioxo-1,3-diazinane-5-carbonyl)amino]acetic acid |
| InChI | InChI=1S/C19H27N3O6/c23-14(24)11-20-16(25)15-17(26)21(12-7-3-1-4-8-12)19(28)22(18(15)27)13-9-5-2-6-10-13/h12-13,15H,1-11H2,(H,20,25)(H,23,24) |
| InChIKey | RUEYEZADQJCKGV-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C(=O)C(C(=O)N(C2=O)C3CCCCC3)C(=O)NCC(=O)O |
