For research use only. Not for therapeutic Use.
GSK1325756(Cat No.:I005656), also known as Danirixin, is a selective CXCR2 antagonist that inhibits neutrophil activation and migration. It is primarily researched for its potential to treat chronic obstructive pulmonary disease (COPD) and other inflammatory respiratory conditions. By blocking the CXCR2 receptor, GSK1325756 reduces the inflammatory response in the lungs, decreasing tissue damage caused by excessive neutrophil infiltration. This compound is valuable for studying inflammatory pathways and immune modulation, particularly in diseases where neutrophil-driven inflammation plays a significant role. GSK1325756 offers insights into developing novel therapies for managing chronic inflammation in respiratory disorders.
CAS Number | 954126-98-8 |
Synonyms | GSK1325756;GSK1325756B |
Molecular Formula | C₁₉H₂₁ClFN₃O₄S |
Purity | ≥95% |
Target | Immunology/Inflammation |
Solubility | DMSO: ≤ 8 mg/mL |
Storage | -20°C |
IC50 | 12.5 nM |
IUPAC Name | 1-[4-chloro-2-hydroxy-3-[(3S)-piperidin-3-yl]sulfonylphenyl]-3-(3-fluoro-2-methylphenyl)urea |
InChI | InChI=1S/C19H21ClFN3O4S/c1-11-14(21)5-2-6-15(11)23-19(26)24-16-8-7-13(20)18(17(16)25)29(27,28)12-4-3-9-22-10-12/h2,5-8,12,22,25H,3-4,9-10H2,1H3,(H2,23,24,26)/t12-/m0/s1 |
InChIKey | NGYNBSHYFOFVLS-LBPRGKRZSA-N |
SMILES | CC1=C(C=CC=C1F)NC(=O)NC2=C(C(=C(C=C2)Cl)S(=O)(=O)[C@H]3CCCNC3)O |