For research use only. Not for therapeutic Use.
GSK1940029 (SCD inhibitor 1) is a stearoyl-coa desaturase (SCD) inhibitor extracted from patent WO/2009060053 A1, compound example 16.
GSK1940029 (SCD inhibitor 1) is a stearoyl-coa desaturase (SCD), which can be used to treat and/or preventing various diseases, including those mediated by SCD enzyme, such as diseases related to elevated lipid levels, cardiovascular disease, diabetes, obesity, metabolic syndrome, skin disorders such as acne, diseases or conditions related to cancer and the treatment of symptoms linked to the production of the amyloid plaque-forming Aβ42 peptide such as Alzheimer’s disease[1].
| Catalog Number | I000557 |
| CAS Number | 1150701-66-8 |
| Synonyms | 1-[(3,4-dichlorophenyl)methyl]-N-[4-(hydroxymethyl)phenyl]-5-methyltriazole-4-carboxamide |
| Molecular Formula | C18H16Cl2N4O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C18H16Cl2N4O2/c1-11-17(18(26)21-14-5-2-12(10-25)3-6-14)22-23-24(11)9-13-4-7-15(19)16(20)8-13/h2-8,25H,9-10H2,1H3,(H,21,26) |
| InChIKey | QQRGSFYTPBYCFD-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1CC2=CC(=C(C=C2)Cl)Cl)C(=O)NC3=CC=C(C=C3)CO |
| Reference | [1]. Anne Marie Jeanne Bouillot, et al. 1, 2, 3-triazole derivatives for use as stearoyl-coa desaturase inhibitors . PCT Int. Appl. (2009), WO 2009060053 A1 20090514. |
