For research use only. Not for therapeutic Use.
GSK2141795 hydrochloride(Cat No.:I000264)is a selective inhibitor of the enzyme phosphodiesterase 4 (PDE4), which plays a key role in regulating inflammatory pathways, particularly in immune cells. By inhibiting PDE4, GSK2141795 reduces the breakdown of cyclic AMP (cAMP), leading to decreased production of pro-inflammatory cytokines and mediators. This makes it a potential therapeutic agent for inflammatory and autoimmune diseases, such as chronic obstructive pulmonary disease (COPD) and psoriasis. It is currently in clinical trials to assess its safety, efficacy, and optimal dosing, with early studies showing promise in managing inflammation-related conditions.
CAS Number | 1047635-80-2 |
Synonyms | N-((S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl)-5-chloro-4-(4-chloro-1-methyl-1H-pyrazol-5-yl)furan-2-carboxamide hydrochloride |
Molecular Formula | C18H17Cl3F2N4O2 |
Purity | ≥95% |
Target | Akt |
Solubility | 10 mM in DMSO |
Storage | Store at -20C |
IC50 | 180/328/38 nM (Akt1/2/3) |
IUPAC Name | N-[(2S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl]-5-chloro-4-(4-chloro-2-methylpyrazol-3-yl)furan-2-carboxamide;hydrochloride |
InChI | InChI=1S/C18H16Cl2F2N4O2.ClH/c1-26-16(12(19)8-24-26)11-6-15(28-17(11)20)18(27)25-10(7-23)4-9-2-3-13(21)14(22)5-9;/h2-3,5-6,8,10H,4,7,23H2,1H3,(H,25,27);1H/t10-;/m0./s1 |
InChIKey | LAPFKCIDRPWAFU-PPHPATTJSA-N |
SMILES | CN1C(=C(C=N1)Cl)C2=C(OC(=C2)C(=O)N[C@@H](CC3=CC(=C(C=C3)F)F)CN)Cl.Cl |