For research use only. Not for therapeutic Use.
GSK2141795（Cat No.:I000263）is a potent, selective inhibitor of AKT, a key component of the PI3K/AKT/mTOR signaling pathway, which plays a crucial role in regulating cell growth, survival, and metabolism. This compound has been extensively studied for its potential in cancer therapy, particularly in tumors with dysregulated AKT activity. By inhibiting AKT, GSK2141795 disrupts cancer cell proliferation and induces apoptosis, making it a valuable tool in exploring therapeutic strategies for cancers such as breast, ovarian, and prostate cancer. It is used in preclinical and clinical studies to assess its efficacy and therapeutic potential.
| Catalog Number | I000263 |
| CAS Number | 1047634-65-0 |
| Synonyms | N-((S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl)-5-chloro-4-(4-chloro-1-methyl-1H-pyrazol-5-yl)furan-2-carboxamide |
| Molecular Formula | C18H16Cl2F2N4O2 |
| Purity | ≥95% |
| Target | Akt |
| Solubility | DMSO: ≥ 36 mg/mL |
| Storage | Store at -20°C |
| IC50 | 180/328/38 nM (Akt1/2/3) |
| IUPAC Name | N-[(2S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl]-5-chloro-4-(4-chloro-2-methylpyrazol-3-yl)furan-2-carboxamide |
| InChI | InChI=1S/C18H16Cl2F2N4O2/c1-26-16(12(19)8-24-26)11-6-15(28-17(11)20)18(27)25-10(7-23)4-9-2-3-13(21)14(22)5-9/h2-3,5-6,8,10H,4,7,23H2,1H3,(H,25,27)/t10-/m0/s1 |
| InChIKey | AXTAPYRUEKNRBA-JTQLQIEISA-N |
| SMILES | CN1C(=C(C=N1)Cl)C2=C(OC(=C2)C(=O)N[C@@H](CC3=CC(=C(C=C3)F)F)CN)Cl |
| Reference | <p style=/line-height:25px/> |
