For research use only. Not for therapeutic Use.
GSK2190915 sodium salt(Cat No.:I000713)is a selective inhibitor of the protein kinase C (PKC) enzyme family, specifically targeting PKCα and PKCβ. PKC enzymes are involved in various cellular processes, including cell growth, differentiation, and signal transduction. GSK2190915 has been investigated for its potential therapeutic applications in conditions such as cancer, inflammation, and autoimmune diseases, as PKC plays a role in regulating immune cell responses and tumor progression. Research is ongoing to explore its effectiveness and safety, as well as its potential to treat diseases driven by dysregulated PKC activity.
CAS Number | 1196070-26-4 |
Synonyms | sodium 3-(3-(tert-butylthio)-1-(4-(6-ethoxypyridin-3-yl)benzyl)-5-((5-methylpyridin-2-yl)methoxy)-1H-indol-2-yl)-2,2-dimethylpropanoate |
Molecular Formula | C38H42N3NaO4S |
Purity | ≥95% |
Target | GPCR/G Protein |
Solubility | DMSO: ≥ 32 mg/mL |
Storage | Store at -20°C |
IC50 | 76 nM (inhibition of LTB4 in human blood 5 h incubation) [1] |
IUPAC Name | sodium;3-[3-tert-butylsulfanyl-1-[[4-(6-ethoxypyridin-3-yl)phenyl]methyl]-5-[(5-methylpyridin-2-yl)methoxy]indol-2-yl]-2,2-dimethylpropanoate |
InChI | InChI=1S/C38H43N3O4S.Na/c1-8-44-34-18-14-28(22-40-34)27-12-10-26(11-13-27)23-41-32-17-16-30(45-24-29-15-9-25(2)21-39-29)19-31(32)35(46-37(3,4)5)33(41)20-38(6,7)36(42)43;/h9-19,21-22H,8,20,23-24H2,1-7H3,(H,42,43);/q;+1/p-1 |
InChIKey | NOJNFULGOQGBKB-UHFFFAOYSA-M |
SMILES | CCOC1=NC=C(C=C1)C2=CC=C(C=C2)CN3C4=C(C=C(C=C4)OCC5=NC=C(C=C5)C)C(=C3CC(C)(C)C(=O)[O-])SC(C)(C)C.[Na+] |
Reference | <p style=/line-height:25px/> |