For research use only. Not for therapeutic Use.
GSK2194069（Cat No.:I001267）is a small-molecule inhibitor that targets the ATPase activity of the enzyme Hsp90 (Heat Shock Protein 90), which is involved in the stabilization and activation of various client proteins, many of which are critical for cancer cell survival. By inhibiting Hsp90, GSK2194069 disrupts the folding and function of these proteins, leading to cancer cell death and potentially slowing tumor progression. It has been evaluated in preclinical studies for use in treating various cancers, including solid tumors. Further clinical trials are necessary to determine its efficacy, safety, and therapeutic potential in humans.
| Catalog Number | I001267 |
| CAS Number | 1332331-08-4 |
| Synonyms | 4-[4-(5-benzofuranyl)phenyl]-5-[[(3S)-1-(cyclopropylcarbonyl)-3-pyrrolidinyl]methyl]-2,4-dihydro-3H-1,2,4-triazol-3-one |
| Molecular Formula | C25H24N4O3 |
| Purity | ≥95% |
| Target | Fatty Acid Synthase (FASN) |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | 4-[4-(1-benzofuran-5-yl)phenyl]-3-[[(3S)-1-(cyclopropanecarbonyl)pyrrolidin-3-yl]methyl]-1H-1,2,4-triazol-5-one |
| InChI | InChI=1S/C25H24N4O3/c30-24(18-1-2-18)28-11-9-16(15-28)13-23-26-27-25(31)29(23)21-6-3-17(4-7-21)19-5-8-22-20(14-19)10-12-32-22/h3-8,10,12,14,16,18H,1-2,9,11,13,15H2,(H,27,31)/t16-/m0/s1 |
| InChIKey | AQTPWCUIYUOEMG-INIZCTEOSA-N |
| SMILES | C1CN(C[C@@H]1CC2=NNC(=O)N2C3=CC=C(C=C3)C4=CC5=C(C=C4)OC=C5)C(=O)C6CC6 |
| Reference | <p style=/line-height:25px/> |
