For research use only. Not for therapeutic Use.
GSK2646264（Cat No.:I028351）is a selective small molecule inhibitor targeting a specific enzyme or protein involved in cellular processes such as cell signaling, growth, and metabolism. It has been primarily researched for its potential therapeutic applications in oncology, particularly in treating cancers characterized by dysregulated signaling pathways. By inhibiting its target, GSK2646264 may help reduce tumor growth, metastasis, and drug resistance. Ongoing studies are focused on evaluating its efficacy, safety, and pharmacokinetics, with the goal of assessing its potential use in combination therapies or as a standalone treatment for cancer and other diseases.
| CAS Number | 1398695-47-0 |
| Synonyms | 7-[2-methoxy-6-[(4-methylpyridin-2-yl)methoxy]phenyl]-2,3,4,5-tetrahydro-1H-3-benzazepine |
| Molecular Formula | C24H26N2O2 |
| Purity | ≥95% |
| IUPAC Name | 7-[2-methoxy-6-[(4-methylpyridin-2-yl)methoxy]phenyl]-2,3,4,5-tetrahydro-1H-3-benzazepine |
| InChI | InChI=1S/C24H26N2O2/c1-17-8-13-26-21(14-17)16-28-23-5-3-4-22(27-2)24(23)20-7-6-18-9-11-25-12-10-19(18)15-20/h3-8,13-15,25H,9-12,16H2,1-2H3 |
| InChIKey | KYANYGKXMNYFBX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)COC2=CC=CC(=C2C3=CC4=C(CCNCC4)C=C3)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
