For research use only. Not for therapeutic Use.
GSK2838232（Cat No.:I001707） is a compound described in patent WO/2013090664A1 (compound 51) and it has been reported to inhibit the activity of HIV reverse transcriptase. It demonstrates inhibitory effects across a broad range of HIV-1 isolates. Reverse transcriptase is an essential enzyme for the replication of the HIV virus, and inhibiting its activity can disrupt the viral replication cycle. GSK2838232 shows potential as a candidate for further development as an anti-HIV therapeutic agent.
| Catalog Number | I001707 |
| CAS Number | 1443460-91-0 |
| Synonyms | (3β)-3-(3-carboxy-3-methyl-1-oxobutoxy)-17-[(1R)-2-[[(4-chlorophenyl)methyl][2-(dimethylamino)ethyl]amino]-1-hydroxyethyl]-28-norlup-18-en-21-one |
| Molecular Formula | C48H73ClN2O6 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | 4-[[(3aR,5aR,5bR,7aR,9S,11aR,11bR,13aS)-3a-[(1R)-2-[(4-chlorophenyl)methyl-[2-(dimethylamino)ethyl]amino]-1-hydroxyethyl]-5a,5b,8,8,11a-pentamethyl-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3H-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid |
| InChI | InChI=1S/C48H73ClN2O6/c1-30(2)40-34(52)26-48(37(53)29-51(25-24-50(10)11)28-31-12-14-32(49)15-13-31)23-22-46(8)33(41(40)48)16-17-36-45(7)20-19-38(57-39(54)27-43(3,4)42(55)56)44(5,6)35(45)18-21-47(36,46)9/h12-15,30,33,35-38,53H,16-29H2,1-11H3,(H,55,56)/t33-,35+,36-,37+,38+,45+,46-,47-,48+/m1/s1 |
| InChIKey | MEOWKUXNVNJAMY-PZFKGGKESA-N |
| SMILES | CC(C)C1=C2C3CCC4C5(CCC(C(C5CCC4(C3(CCC2(CC1=O)C(CN(CCN(C)C)CC6=CC=C(C=C6)Cl)O)C)C)(C)C)OC(=O)CC(C)(C)C(=O)O)C |
| Reference | <p style=/line-height:25px/> |
