For research use only. Not for therapeutic Use.
GSK329（Cat No.:I028366）is a small molecule compound that functions as a selective inhibitor of a specific target protein or enzyme involved in key cellular processes, such as signal transduction, metabolism, or immune regulation. It is being studied for its potential therapeutic applications in cancer, autoimmune diseases, and inflammatory conditions. By modulating the activity of its target, GSK329 may help regulate cell growth, survival, and immune response. Ongoing research aims to evaluate its efficacy, safety, and pharmacokinetics, with a focus on determining its clinical potential in treating various diseases, particularly in targeted therapies.
| CAS Number | 1268490-12-5 |
| Synonyms | 1-[3,5-dichloro-4-[6-(methylamino)pyrimidin-4-yl]oxyphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| Molecular Formula | C19H14Cl2F3N5O2 |
| Purity | ≥95% |
| IUPAC Name | 1-[3,5-dichloro-4-[6-(methylamino)pyrimidin-4-yl]oxyphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| InChI | InChI=1S/C19H14Cl2F3N5O2/c1-25-15-8-16(27-9-26-15)31-17-13(20)6-12(7-14(17)21)29-18(30)28-11-4-2-3-10(5-11)19(22,23)24/h2-9H,1H3,(H,25,26,27)(H2,28,29,30) |
| InChIKey | QOQADIYOLOHRAW-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=NC=N1)OC2=C(C=C(C=C2Cl)NC(=O)NC3=CC=CC(=C3)C(F)(F)F)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
