For research use only. Not for therapeutic Use.
GSK3987（Cat No.:I011912）is a small molecule compound under investigation for its potential therapeutic applications, particularly in the fields of oncology and inflammatory diseases. It is designed to selectively target specific enzymes or proteins involved in cell signaling, immune response, or cellular growth pathways. By modulating these critical processes, GSK3987 may help inhibit tumor progression, reduce inflammation, and improve the effectiveness of existing treatments. Ongoing studies are focused on evaluating its safety, efficacy, and pharmacokinetics, with the aim of determining its clinical potential in treating various diseases, including cancers and autoimmune disorders.
| CAS Number | 264206-85-1 |
| Synonyms | 1-benzyl-3-(4-methoxyanilino)-4-phenylpyrrole-2,5-dione |
| Molecular Formula | C24H20N2O3 |
| Purity | ≥95% |
| IUPAC Name | 1-benzyl-3-(4-methoxyanilino)-4-phenylpyrrole-2,5-dione |
| InChI | InChI=1S/C24H20N2O3/c1-29-20-14-12-19(13-15-20)25-22-21(18-10-6-3-7-11-18)23(27)26(24(22)28)16-17-8-4-2-5-9-17/h2-15,25H,16H2,1H3 |
| InChIKey | HLZMYWLMBBLASX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=C(C(=O)N(C2=O)CC3=CC=CC=C3)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
