For research use only. Not for therapeutic Use.
GSK5182 is a synthetic small molecule that functions as a selective inverse agonist of the estrogen-related receptor gamma (ERRγ). ERRγ is a nuclear receptor involved in the regulation of energy metabolism, glucose homeostasis, and various physiological processes. By inhibiting ERRγ activity, GSK5182 has shown potential in modulating metabolic pathways, making it a candidate for research in metabolic disorders, including type 2 diabetes and obesity. Additionally, GSK5182 is being studied for its potential anticancer effects, particularly in cancers where ERRγ plays a role in tumor progression.
CAS Number | 877387-37-6 |
Molecular Formula | C27H31NO3 |
Purity | ≥95% |
InChI | InChI=1S/C27H31NO3/c1-28(2)18-20-31-25-16-12-23(13-17-25)27(22-10-14-24(30)15-11-22)26(9-6-19-29)21-7-4-3-5-8-21/h3-5,7-8,10-17,29-30H,6,9,18-20H2,1-2H3/b27-26- |
InChIKey | ZVSFNBNLNLXEFQ-RQZHXJHFSA-N |
SMILES | CN(C)CCOC1=CC=C(C=C1)C(=C(CCCO)C2=CC=CC=C2)C3=CC=C(C=C3)O |