For research use only. Not for therapeutic Use.
GSK854(Cat No.:I012596)is an investigational small molecule compound being studied for its potential therapeutic applications, particularly in the treatment of cancer. It is designed to target and inhibit specific kinases involved in cellular processes such as growth, survival, and metastasis. By blocking these pathways, GSK854 may help to slow tumor progression and enhance the effectiveness of other cancer therapies. Preclinical research is focused on evaluating its efficacy against various cancer types, while clinical trials are assessing its safety, pharmacokinetics, and potential benefits as part of combination treatments in oncology.
CAS Number | 1316059-00-3 |
Synonyms | 3-[6-(5-Chloro-pyridin-2-ylamino)-pyrimidin-4-ylamino]-4-ethanesulfonyl-N-methyl-benzenesulfonamide |
Molecular Formula | C18H19ClN6O4S2 |
Purity | ≥95% |
IUPAC Name | 3-[[6-[(5-chloropyridin-2-yl)amino]pyrimidin-4-yl]amino]-4-ethylsulfonyl-N-methylbenzenesulfonamide |
InChI | InChI=1S/C18H19ClN6O4S2/c1-3-30(26,27)15-6-5-13(31(28,29)20-2)8-14(15)24-17-9-18(23-11-22-17)25-16-7-4-12(19)10-21-16/h4-11,20H,3H2,1-2H3,(H2,21,22,23,24,25) |
InChIKey | OEDGERSSZUMLBI-UHFFFAOYSA-N |
SMILES | CCS(=O)(=O)C1=C(C=C(C=C1)S(=O)(=O)NC)NC2=NC=NC(=C2)NC3=NC=C(C=C3)Cl |