For research use only. Not for therapeutic Use.
Guadecitabine (SGI-110)(Cat No.:I007134)is a synthetic nucleoside analog and a potent inhibitor of DNA methyltransferases, specifically DNMT1 and DNMT3A. By inhibiting these enzymes, Guadecitabine prevents DNA methylation, a key epigenetic modification involved in gene silencing and cancer progression. It reactivates tumor suppressor genes and enhances the immune response, making it a promising therapeutic candidate for cancer treatment. Guadecitabine is being investigated in clinical trials for various cancers, including hematological malignancies and solid tumors, where it has shown potential to improve outcomes by reversing epigenetic changes associated with tumorigenesis.
CAS Number | 929901-49-5 |
Synonyms | SGI110; SGI-110; SGI 110; S110; Guadecitabine;(2R,3S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1(2H)-yl)-2-(hydroxymethyl)tetrahydrofuran-3-yl (((2S,3R,5R)-5-(2-amino-6-oxo-1H-purin-9(6H)-yl)-3-hydroxytetrahydrofuran-2-yl)methyl) hydrogen phosphate |
Molecular Formula | C18H24N9O10P |
Purity | ≥95% |
Target | DNA Methyltransferase |
Solubility | Soluble in DMSO, not in water |
Storage | Store at -20°C |
IUPAC Name | [(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl [(2R,3S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate |
InChI | InChI=1S/C18H24N9O10P/c19-16-22-6-27(18(31)25-16)12-2-8(9(3-28)35-12)37-38(32,33)34-4-10-7(29)1-11(36-10)26-5-21-13-14(26)23-17(20)24-15(13)30/h5-12,28-29H,1-4H2,(H,32,33)(H2,19,25,31)(H3,20,23,24,30)/t7-,8-,9+,10+,11+,12+/m0/s1 |
InChIKey | GUWXKKAWLCENJA-WGWHJZDNSA-N |
SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)O[C@H]4C[C@@H](O[C@@H]4CO)N5C=NC(=NC5=O)N)O |