For research use only. Not for therapeutic Use.
Guanabenz（Cat No.:M004877）is an alpha-2 adrenergic receptor agonist primarily used as an antihypertensive agent to treat high blood pressure. By stimulating alpha-2 receptors in the central nervous system, it reduces sympathetic nervous system activity, leading to a decrease in heart rate and blood vessel constriction, which lowers blood pressure. In addition to its antihypertensive effects, Guanabenz has shown potential neuroprotective properties, making it of interest in research for neurodegenerative diseases such as multiple sclerosis. Its central mode of action makes it a valuable option for managing hypertension.
| Catalog Number | M004877 |
| CAS Number | 5051-62-7 |
| Synonyms | GUANABENZ;1-(2,6-DICHLOROBENZYLIDENEAMINO)GUANIDINE;2-[(2,6-dichlorophenyl)methylene]-hydrazinecarboximidamide;n-(2,6-dichlorobenzylidene)amino]guanidine;n-(2,6-dichlorobenzylidene)-n’-amidinohydrazine;nsc-68982;Rexitene;HydrazinecarboxiMidaMide, 2-[ |
| Molecular Formula | C8H8Cl2N4 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | 2-[(E)-(2,6-dichlorophenyl)methylideneamino]guanidine |
| InChI | InChI=1S/C8H8Cl2N4/c9-6-2-1-3-7(10)5(6)4-13-14-8(11)12/h1-4H,(H4,11,12,14)/b13-4+ |
| InChIKey | WDZVGELJXXEGPV-YIXHJXPBSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)/C=N/N=C(N)N)Cl |
| Reference | 1: Neuber C, Uebeler J, Schulze T, Sotoud H, El-Armouche A, Eschenhagen T. 2: Takigawa S, Chen A, Nishimura A, Liu S, Li BY, Sudo A, Yokota H, Hamamura K. 3: Wang L, Popko B, Tixier E, Roos RP. Guanabenz, which enhances the unfolded 4: Osborn MF, Alterman JF, Nikan M, Cao H, Didiot MC, Hassler MR, Coles AH, <br> <br> |
