For research use only. Not for therapeutic Use.
Guanadrel（Cat No.:I028449）is a synthetic antihypertensive agent used primarily in the treatment of high blood pressure. It works by inhibiting the release of norepinephrine, thereby reducing sympathetic nervous system activity and leading to a decrease in blood pressure. Guanadrel is often prescribed when other medications are ineffective or not well tolerated. It is typically administered orally and is known to have fewer side effects compared to other antihypertensive drugs. However, it may still cause dizziness or lightheadedness, especially when standing up quickly.
| CAS Number | 40580-59-4 |
| Synonyms | 2-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)guanidine |
| Molecular Formula | C10H19N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2-(1,4-dioxaspiro[4.5]decan-3-ylmethyl)guanidine |
| InChI | InChI=1S/C10H19N3O2/c11-9(12)13-6-8-7-14-10(15-8)4-2-1-3-5-10/h8H,1-7H2,(H4,11,12,13) |
| InChIKey | HPBNRIOWIXYZFK-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)OCC(O2)CN=C(N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
