Guanidine-13C,15N3 Hydrochloride is a labeled derivative of guanidine hydrochloride, where one carbon atom is replaced with 13C and three nitrogen atoms are replaced with 15N. This isotopically enriched compound is used as an internal standard in mass spectrometry and NMR spectroscopy, aiding in precise quantification and structural elucidation. In pharmaceutical chemistry, it supports studies on drug metabolism and pharmacokinetics. In organic chemistry, it is valuable for mechanistic studies and isotope dilution assays. Its stable isotope labeling enhances accuracy and reliability in analytical applications, making it crucial for high-precision scientific research.
| Catalog Number | R027856 |
| CAS Number | 285977-73-3 |
| Synonyms | Guanidine-13C-15N3, Monohydrochloride |
| Molecular Formula | CH6ClN3 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (13C)guanidine;hydrochloride |
| InChI | InChI=1S/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H/i1+1,2+1,3+1,4+1; |
| InChIKey | PJJJBBJSCAKJQF-UJNKEPEOSA-N |
| SMILES | [13C](=[15NH])([15NH2])[15NH2].Cl |
